C19H23ClN4O — CID 131690978
(6-chloroimidazo[1,2-a]pyridin-2-yl)-(1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)methanone (PubChem CID 131690978) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-a]pyridin-2-yl)-(1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)methanone.
| Compound Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)-(1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)methanone |
|---|---|
| PubChem CID | 131690978 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)-(1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)methanone |
| SMILES | C=CCN1CCCC12CCCN(C(=O)c1cn3cc(Cl)ccc3n1)C2 |
| InChI | InChI=1S/C19H23ClN4O/c1-2-9-24-11-4-8-19(24)7-3-10-22(14-19)18(25)16-13-23-12-15(20)5-6-17(23)21-16/h2,5-6,12-13H,1,3-4,7-11,14H2 |
| InChIKey | RYHDKTOUQNKVJT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|