C17H21N3O3 — CID 95708619
[(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[3-(1H-imidazol-2-yl)phenyl]methanone (PubChem CID 95708619) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[3-(1H-imidazol-2-yl)phenyl]methanone.
| Compound Name | [(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[3-(1H-imidazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 95708619 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [(4R)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[3-(1H-imidazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2ncc[nH]2)c1)N1CCC[C@](O)(CO)CC1 |
| InChI | InChI=1S/C17H21N3O3/c21-12-17(23)5-2-9-20(10-6-17)16(22)14-4-1-3-13(11-14)15-18-7-8-19-15/h1,3-4,7-8,11,21,23H,2,5-6,9-10,12H2,(H,18,19)/t17-/m1/s1 |
| InChIKey | YUJLPWIKTLCKTK-QGZVFWFLSA-N |
| XLogP | 1.43 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |