C12H12ClNO — CID 141178418
(3-chlorophenyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 141178418) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is (3-chlorophenyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (3-chlorophenyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 141178418 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (3-chlorophenyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CC=CCC1 |
| InChI | InChI=1S/C12H12ClNO/c13-11-6-4-5-10(9-11)12(15)14-7-2-1-3-8-14/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | NYQYZZOQLVYEHK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|