C18H24ClN2O+ — CID 7108845
(3-chlorophenyl)-[4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 7108845) has the molecular formula C18H24ClN2O+ and a molecular weight of 319.86 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 7108845 |
| Molecular Formula | C18H24ClN2O+ |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (3-chlorophenyl)-[4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CC[NH+](C[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C18H23ClN2O/c19-17-8-4-7-16(13-17)18(22)21-11-9-20(10-12-21)14-15-5-2-1-3-6-15/h1-2,4,7-8,13,15H,3,5-6,9-12,14H2/p+1/t15-/m0/s1 |
| InChIKey | KJEAZMMNNREOQT-HNNXBMFYSA-O |
| XLogP | 2.04 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|