C18H24FN2O+ — CID 4741651
[4-(cyclohex-3-en-1-ylmethyl)piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone (PubChem CID 4741651) has the molecular formula C18H24FN2O+ and a molecular weight of 303.40 g/mol. Its IUPAC name is [4-(cyclohex-3-en-1-ylmethyl)piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-(cyclohex-3-en-1-ylmethyl)piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 4741651 |
| Molecular Formula | C18H24FN2O+ |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | [4-(cyclohex-3-en-1-ylmethyl)piperazin-4-ium-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CC[NH+](CC2CC=CCC2)CC1 |
| InChI | InChI=1S/C18H23FN2O/c19-17-9-5-4-8-16(17)18(22)21-12-10-20(11-13-21)14-15-6-2-1-3-7-15/h1-2,4-5,8-9,15H,3,6-7,10-14H2/p+1 |
| InChIKey | VRESTRQCPRLWKN-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|