C16H23N2O2+ — CID 6945648
[4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone (PubChem CID 6945648) has the molecular formula C16H23N2O2+ and a molecular weight of 275.37 g/mol. Its IUPAC name is [4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 6945648 |
| Molecular Formula | C16H23N2O2+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | [4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CC[NH+](C[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C16H22N2O2/c19-16(15-7-4-12-20-15)18-10-8-17(9-11-18)13-14-5-2-1-3-6-14/h1-2,4,7,12,14H,3,5-6,8-11,13H2/p+1/t14-/m0/s1 |
| InChIKey | BKXQZJXFMRTHCS-AWEZNQCLSA-O |
| XLogP | 0.98 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|