C18H28N2+2 — CID 7320074
1-benzyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium (PubChem CID 7320074) has the molecular formula C18H28N2+2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-benzyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7320074 |
| Molecular Formula | C18H28N2+2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 1-benzyl-4-[[(1R)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium |
| SMILES | C1=CC[C@H](C[NH+]2CC[NH+](Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C18H26N2/c1-3-7-17(8-4-1)15-19-11-13-20(14-12-19)16-18-9-5-2-6-10-18/h1-5,7-8,18H,6,9-16H2/p+2/t18-/m0/s1 |
| InChIKey | VMOVHEKNZJZXFB-SFHVURJKSA-P |
| XLogP | 0.33 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|