C19H30N2O+2 — CID 6945656
1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 6945656) has the molecular formula C19H30N2O+2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6945656 |
| Molecular Formula | C19H30N2O+2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | COc1ccc(C[NH+]2CC[NH+](C[C@@H]3CC=CCC3)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O/c1-22-19-9-7-18(8-10-19)16-21-13-11-20(12-14-21)15-17-5-3-2-4-6-17/h2-3,7-10,17H,4-6,11-16H2,1H3/p+2/t17-/m1/s1 |
| InChIKey | ZTAZSXIAIPIZNM-QGZVFWFLSA-P |
| XLogP | 0.33 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|