C18H27ClN2+2 — CID 7108996
1-[(4-chlorophenyl)methyl]-4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium (PubChem CID 7108996) has the molecular formula C18H27ClN2+2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7108996 |
| Molecular Formula | C18H27ClN2+2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-[[(1S)-cyclohex-3-en-1-yl]methyl]piperazine-1,4-diium |
| SMILES | Clc1ccc(C[NH+]2CC[NH+](C[C@@H]3CC=CCC3)CC2)cc1 |
| InChI | InChI=1S/C18H25ClN2/c19-18-8-6-17(7-9-18)15-21-12-10-20(11-13-21)14-16-4-2-1-3-5-16/h1-2,6-9,16H,3-5,10-15H2/p+2/t16-/m1/s1 |
| InChIKey | DFEKGEVTPASXGK-MRXNPFEDSA-P |
| XLogP | 0.98 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|