C23H28Cl2N2+2 — CID 7282844
1,3-bis[(4-chlorophenyl)methyl]-2-[(1R)-cyclohex-3-en-1-yl]imidazolidine-1,3-diium (PubChem CID 7282844) has the molecular formula C23H28Cl2N2+2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1,3-bis[(4-chlorophenyl)methyl]-2-[(1R)-cyclohex-3-en-1-yl]imidazolidine-1,3-diium.
| Compound Name | 1,3-bis[(4-chlorophenyl)methyl]-2-[(1R)-cyclohex-3-en-1-yl]imidazolidine-1,3-diium |
|---|---|
| PubChem CID | 7282844 |
| Molecular Formula | C23H28Cl2N2+2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1,3-bis[(4-chlorophenyl)methyl]-2-[(1R)-cyclohex-3-en-1-yl]imidazolidine-1,3-diium |
| SMILES | Clc1ccc(C[NH+]2CC[NH+](Cc3ccc(Cl)cc3)C2[C@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C23H26Cl2N2/c24-21-10-6-18(7-11-21)16-26-14-15-27(17-19-8-12-22(25)13-9-19)23(26)20-4-2-1-3-5-20/h1-2,6-13,20,23H,3-5,14-17H2/p+2/t20-/m0/s1 |
| InChIKey | IWAXPVCBPVNXPQ-FQEVSTJZSA-P |
| XLogP | 3.16 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|