C21H26ClN2O+ — CID 8590026
N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2,5-dimethylbenzamide (PubChem CID 8590026) has the molecular formula C21H26ClN2O+ and a molecular weight of 357.91 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2,5-dimethylbenzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 8590026 |
| Molecular Formula | C21H26ClN2O+ |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NC2CC[NH+](Cc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25ClN2O/c1-15-3-4-16(2)20(13-15)21(25)23-19-9-11-24(12-10-19)14-17-5-7-18(22)8-6-17/h3-8,13,19H,9-12,14H2,1-2H3,(H,23,25)/p+1 |
| InChIKey | JNPILMOYHNDWML-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |