C22H26ClN2O+ — CID 8590205
(E)-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 8590205) has the molecular formula C22H26ClN2O+ and a molecular weight of 369.92 g/mol. Its IUPAC name is (E)-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8590205 |
| Molecular Formula | C22H26ClN2O+ |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (E)-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC2CC[NH+](Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25ClN2O/c1-17-2-4-18(5-3-17)8-11-22(26)24-21-12-14-25(15-13-21)16-19-6-9-20(23)10-7-19/h2-11,21H,12-16H2,1H3,(H,24,26)/p+1/b11-8+ |
| InChIKey | QAMPJPVBSYMWET-DHZHZOJOSA-O |
| XLogP | 3.03 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|