C17H24ClN2O+ — CID 9264536
(E)-3-(3-chlorophenyl)-N-(1-propylpiperidin-1-ium-4-yl)prop-2-enamide (PubChem CID 9264536) has the molecular formula C17H24ClN2O+ and a molecular weight of 307.84 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(1-propylpiperidin-1-ium-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(1-propylpiperidin-1-ium-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9264536 |
| Molecular Formula | C17H24ClN2O+ |
| Molecular Weight | 307.84 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(1-propylpiperidin-1-ium-4-yl)prop-2-enamide |
| SMILES | CCC[NH+]1CCC(NC(=O)/C=C/c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23ClN2O/c1-2-10-20-11-8-16(9-12-20)19-17(21)7-6-14-4-3-5-15(18)13-14/h3-7,13,16H,2,8-12H2,1H3,(H,19,21)/p+1/b7-6+ |
| InChIKey | ZQTUZXSCCWMUBF-VOTSOKGWSA-O |
| XLogP | 1.93 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.84 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|