C20H23ClFN2O+ — CID 8934739
N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-fluoro-4-methylbenzamide (PubChem CID 8934739) has the molecular formula C20H23ClFN2O+ and a molecular weight of 361.87 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 8934739 |
| Molecular Formula | C20H23ClFN2O+ |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC[NH+](Cc3ccc(Cl)cc3)CC2)cc1F |
| InChI | InChI=1S/C20H22ClFN2O/c1-14-2-5-16(12-19(14)22)20(25)23-18-8-10-24(11-9-18)13-15-3-6-17(21)7-4-15/h2-7,12,18H,8-11,13H2,1H3,(H,23,25)/p+1 |
| InChIKey | ONMMEDGYDVAHBX-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |