C21H26ClN2O3+ — CID 8590009
N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3,4-dimethoxybenzamide (PubChem CID 8590009) has the molecular formula C21H26ClN2O3+ and a molecular weight of 389.90 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 8590009 |
| Molecular Formula | C21H26ClN2O3+ |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CC[NH+](Cc3ccc(Cl)cc3)CC2)cc1OC |
| InChI | InChI=1S/C21H25ClN2O3/c1-26-19-8-5-16(13-20(19)27-2)21(25)23-18-9-11-24(12-10-18)14-15-3-6-17(22)7-4-15/h3-8,13,18H,9-12,14H2,1-2H3,(H,23,25)/p+1 |
| InChIKey | RZRUUIPMLPATEQ-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |