C20H24ClN2OS+ — CID 8590292
N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-methylsulfanylbenzamide (PubChem CID 8590292) has the molecular formula C20H24ClN2OS+ and a molecular weight of 375.95 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-methylsulfanylbenzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 8590292 |
| Molecular Formula | C20H24ClN2OS+ |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)NC2CC[NH+](Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23ClN2OS/c1-25-19-8-4-16(5-9-19)20(24)22-18-10-12-23(13-11-18)14-15-2-6-17(21)7-3-15/h2-9,18H,10-14H2,1H3,(H,22,24)/p+1 |
| InChIKey | STQAJAKMIVDTFZ-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |