C19H20Cl2N3O3+ — CID 8590046
5-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2-nitrobenzamide (PubChem CID 8590046) has the molecular formula C19H20Cl2N3O3+ and a molecular weight of 409.29 g/mol. Its IUPAC name is 5-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 8590046 |
| Molecular Formula | C19H20Cl2N3O3+ |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 5-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-1-ium-4-yl]-2-nitrobenzamide |
| SMILES | O=C(NC1CC[NH+](Cc2ccc(Cl)cc2)CC1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19Cl2N3O3/c20-14-3-1-13(2-4-14)12-23-9-7-16(8-10-23)22-19(25)17-11-15(21)5-6-18(17)24(26)27/h1-6,11,16H,7-10,12H2,(H,22,25)/p+1 |
| InChIKey | NHINOOTUZKTUGH-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|