C13H18Cl2N2O2 — CID 18531723
(3-chlorophenyl)-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]methanone chloride (PubChem CID 18531723) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]methanone chloride.
| Compound Name | (3-chlorophenyl)-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]methanone chloride |
|---|---|
| PubChem CID | 18531723 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (3-chlorophenyl)-[4-(2-hydroxyethyl)piperazin-4-ium-1-yl]methanone chloride |
| SMILES | O=C(c1cccc(Cl)c1)N1CC[NH+](CCO)CC1.[Cl-] |
| InChI | InChI=1S/C13H17ClN2O2.ClH/c14-12-3-1-2-11(10-12)13(18)16-6-4-15(5-7-16)8-9-17;/h1-3,10,17H,4-9H2;1H |
| InChIKey | NREPVMIYWAWWDT-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |