C22H32N4O3 — CID 86937356
methyl 3-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 86937356) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl 3-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | methyl 3-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86937356 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | methyl 3-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(NC(=O)NC2CC3CCC(C2)N3Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N4O3/c1-29-22(28)25-11-5-8-17(15-25)23-21(27)24-18-12-19-9-10-20(13-18)26(19)14-16-6-3-2-4-7-16/h2-4,6-7,17-20H,5,8-15H2,1H3,(H2,23,24,27) |
| InChIKey | VTFHOLPUTHECHV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |