C17H25N3O4 — CID 95637616
methyl (3S)-3-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 95637616) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl (3S)-3-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | methyl (3S)-3-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95637616 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | methyl (3S)-3-[[(2R)-2-methoxy-2-phenylethyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@H](NC(=O)NC[C@H](OC)c2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-15(13-7-4-3-5-8-13)11-18-16(21)19-14-9-6-10-20(12-14)17(22)24-2/h3-5,7-8,14-15H,6,9-12H2,1-2H3,(H2,18,19,21)/t14-,15-/m0/s1 |
| InChIKey | URMIBAMTLIKBIY-GJZGRUSLSA-N |
| XLogP | 1.90 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |