C16H17F3N4S2 — CID 54499776
4-methyl-N-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 54499776) has the molecular formula C16H17F3N4S2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-methyl-N-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54499776 |
| Molecular Formula | C16H17F3N4S2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-methyl-N-[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2nc(-c3ccc(C(F)(F)F)cc3)cs2)CC1 |
| InChI | InChI=1S/C16H17F3N4S2/c1-22-6-8-23(9-7-22)15(24)21-14-20-13(10-25-14)11-2-4-12(5-3-11)16(17,18)19/h2-5,10H,6-9H2,1H3,(H,20,21,24) |
| InChIKey | YBPVHPPIEUCOHT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|