C15H18N4S2 — CID 54455435
4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide (PubChem CID 54455435) has the molecular formula C15H18N4S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54455435 |
| Molecular Formula | C15H18N4S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C15H18N4S2/c1-18-7-9-19(10-8-18)15(20)17-14-16-13(11-21-14)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,16,17,20) |
| InChIKey | WXWMOYWDXLLTFW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|