C16H17F3N2OS — CID 174721637
3,3-dimethyl-2-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]butanal (PubChem CID 174721637) has the molecular formula C16H17F3N2OS and a molecular weight of 342.39 g/mol. Its IUPAC name is 3,3-dimethyl-2-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]butanal.
| Compound Name | 3,3-dimethyl-2-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]butanal |
|---|---|
| PubChem CID | 174721637 |
| Molecular Formula | C16H17F3N2OS |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3,3-dimethyl-2-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]amino]butanal |
| SMILES | CC(C)(C)C(C=O)Nc1nc(-c2ccc(C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C16H17F3N2OS/c1-15(2,3)13(8-22)21-14-20-12(9-23-14)10-4-6-11(7-5-10)16(17,18)19/h4-9,13H,1-3H3,(H,20,21) |
| InChIKey | RBFIODHTDURGFY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|