C20H31N3O2 — CID 70784243
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-(3-hydroxy-3-methylbutyl)benzamide (PubChem CID 70784243) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-(3-hydroxy-3-methylbutyl)benzamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-(3-hydroxy-3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 70784243 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-(3-hydroxy-3-methylbutyl)benzamide |
| SMILES | CN1CCN2C[C@@H](NC(=O)c3ccc(CCC(C)(C)O)cc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H31N3O2/c1-20(2,25)9-8-15-4-6-16(7-5-15)19(24)21-17-12-18-14-22(3)10-11-23(18)13-17/h4-7,17-18,25H,8-14H2,1-3H3,(H,21,24)/t17-,18-/m0/s1 |
| InChIKey | BQDWZHDZHMRKLE-ROUUACIJSA-N |
| XLogP | 1.51 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |