C18H22N2O3 — CID 23510298
2-[(1-methylindole-2-carbonyl)amino]cycloheptane-1-carboxylic acid (PubChem CID 23510298) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[(1-methylindole-2-carbonyl)amino]cycloheptane-1-carboxylic acid.
| Compound Name | 2-[(1-methylindole-2-carbonyl)amino]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 23510298 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[(1-methylindole-2-carbonyl)amino]cycloheptane-1-carboxylic acid |
| SMILES | Cn1c(C(=O)NC2CCCCCC2C(=O)O)cc2ccccc21 |
| InChI | InChI=1S/C18H22N2O3/c1-20-15-10-6-5-7-12(15)11-16(20)17(21)19-14-9-4-2-3-8-13(14)18(22)23/h5-7,10-11,13-14H,2-4,8-9H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | VSKPPEANLZKWFS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |