C23H31N3O3 — CID 58808286
1-methyl-N-[(1S,2R)-2-[[(2S)-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide (PubChem CID 58808286) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-methyl-N-[(1S,2R)-2-[[(2S)-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[(1S,2R)-2-[[(2S)-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 58808286 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-methyl-N-[(1S,2R)-2-[[(2S)-4-methyl-1-oxopentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide |
| SMILES | CC(C)C[C@@H](C=O)NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C23H31N3O3/c1-15(2)12-17(14-27)24-22(28)18-9-5-6-10-19(18)25-23(29)21-13-16-8-4-7-11-20(16)26(21)3/h4,7-8,11,13-15,17-19H,5-6,9-10,12H2,1-3H3,(H,24,28)(H,25,29)/t17-,18+,19-/m0/s1 |
| InChIKey | LJNQZKNOKXKBQO-OTWHNJEPSA-N |
| XLogP | 3.20 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|