C25H35N5O3 — CID 140525731
N-[(1S,2R)-2-[(3-hydrazinylidene-6-methyl-2-oxoheptan-4-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide (PubChem CID 140525731) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[(1S,2R)-2-[(3-hydrazinylidene-6-methyl-2-oxoheptan-4-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-[(3-hydrazinylidene-6-methyl-2-oxoheptan-4-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 140525731 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | N-[(1S,2R)-2-[(3-hydrazinylidene-6-methyl-2-oxoheptan-4-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
| SMILES | CC(=O)C(=NN)C(CC(C)C)NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C25H35N5O3/c1-15(2)13-20(23(29-26)16(3)31)28-24(32)18-10-6-7-11-19(18)27-25(33)22-14-17-9-5-8-12-21(17)30(22)4/h5,8-9,12,14-15,18-20H,6-7,10-11,13,26H2,1-4H3,(H,27,33)(H,28,32)/t18-,19+,20?/m1/s1 |
| InChIKey | RZZGQQMFGSOKPY-LFPSWIHMSA-N |
| XLogP | 2.90 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|