C33H46N4O2 — CID 58808390
1-methyl-N-[(1S,2R)-2-[[4-methyl-1-(4-phenylbutylamino)pentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide (PubChem CID 58808390) has the molecular formula C33H46N4O2 and a molecular weight of 530.76 g/mol. Its IUPAC name is 1-methyl-N-[(1S,2R)-2-[[4-methyl-1-(4-phenylbutylamino)pentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[(1S,2R)-2-[[4-methyl-1-(4-phenylbutylamino)pentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 58808390 |
| Molecular Formula | C33H46N4O2 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 1-methyl-N-[(1S,2R)-2-[[4-methyl-1-(4-phenylbutylamino)pentan-2-yl]carbamoyl]cyclohexyl]indole-2-carboxamide |
| SMILES | CC(C)CC(CNCCCCc1ccccc1)NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C33H46N4O2/c1-24(2)21-27(23-34-20-12-11-15-25-13-5-4-6-14-25)35-32(38)28-17-8-9-18-29(28)36-33(39)31-22-26-16-7-10-19-30(26)37(31)3/h4-7,10,13-14,16,19,22,24,27-29,34H,8-9,11-12,15,17-18,20-21,23H2,1-3H3,(H,35,38)(H,36,39)/t27?,28-,29+/m1/s1 |
| InChIKey | XWSORAVAWXHCOK-WUFLDLQOSA-N |
| XLogP | 5.61 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|