C23H32N4O3 — CID 87733242
N-[(1S,2R)-2-[(1-hydroxyimino-4-methylpentan-2-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide (PubChem CID 87733242) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[(1S,2R)-2-[(1-hydroxyimino-4-methylpentan-2-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-[(1-hydroxyimino-4-methylpentan-2-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 87733242 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[(1S,2R)-2-[(1-hydroxyimino-4-methylpentan-2-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
| SMILES | CC(C)CC(C=NO)NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C23H32N4O3/c1-15(2)12-17(14-24-30)25-22(28)18-9-5-6-10-19(18)26-23(29)21-13-16-8-4-7-11-20(16)27(21)3/h4,7-8,11,13-15,17-19,30H,5-6,9-10,12H2,1-3H3,(H,25,28)(H,26,29)/t17?,18-,19+/m1/s1 |
| InChIKey | CUAHPJWYWORUFQ-CPSIJMPNSA-N |
| XLogP | 3.46 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|