C25H34N4O5 — CID 58808378
2-[(E)-[4-methyl-2-[[(1R,2S)-2-[(1-methylindole-2-carbonyl)amino]cyclohexanecarbonyl]amino]pentylidene]amino]oxyacetic acid (PubChem CID 58808378) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[(E)-[4-methyl-2-[[(1R,2S)-2-[(1-methylindole-2-carbonyl)amino]cyclohexanecarbonyl]amino]pentylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[4-methyl-2-[[(1R,2S)-2-[(1-methylindole-2-carbonyl)amino]cyclohexanecarbonyl]amino]pentylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 58808378 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[(E)-[4-methyl-2-[[(1R,2S)-2-[(1-methylindole-2-carbonyl)amino]cyclohexanecarbonyl]amino]pentylidene]amino]oxyacetic acid |
| SMILES | CC(C)CC(/C=N/OCC(=O)O)NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C25H34N4O5/c1-16(2)12-18(14-26-34-15-23(30)31)27-24(32)19-9-5-6-10-20(19)28-25(33)22-13-17-8-4-7-11-21(17)29(22)3/h4,7-8,11,13-14,16,18-20H,5-6,9-10,12,15H2,1-3H3,(H,27,32)(H,28,33)(H,30,31)/b26-14+/t18?,19-,20+/m1/s1 |
| InChIKey | AARQFFKBSYFTJK-ZHCWWQIHSA-N |
| XLogP | 3.08 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|