C28H34N4O2 — CID 58808291
N-[(1S,2R)-2-[(1-benzylpyrrolidin-3-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide (PubChem CID 58808291) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[(1S,2R)-2-[(1-benzylpyrrolidin-3-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-[(1-benzylpyrrolidin-3-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 58808291 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-[(1S,2R)-2-[(1-benzylpyrrolidin-3-yl)carbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@H]2CCCC[C@H]2C(=O)NC2CCN(Cc3ccccc3)C2)cc2ccccc21 |
| InChI | InChI=1S/C28H34N4O2/c1-31-25-14-8-5-11-21(25)17-26(31)28(34)30-24-13-7-6-12-23(24)27(33)29-22-15-16-32(19-22)18-20-9-3-2-4-10-20/h2-5,8-11,14,17,22-24H,6-7,12-13,15-16,18-19H2,1H3,(H,29,33)(H,30,34)/t22?,23-,24+/m1/s1 |
| InChIKey | VQZBPDYJAZNXCZ-XQFMJXHWSA-N |
| XLogP | 3.86 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |