C22H23N3O3 — CID 119067501
4-(1,3-benzoxazol-5-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide (PubChem CID 119067501) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-5-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide.
| Compound Name | 4-(1,3-benzoxazol-5-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 119067501 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(1,3-benzoxazol-5-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1COC[C@@H]1N1CCCC1)c1ccc(-c2ccc3ocnc3c2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c26-22(24-19-12-27-13-20(19)25-9-1-2-10-25)16-5-3-15(4-6-16)17-7-8-21-18(11-17)23-14-28-21/h3-8,11,14,19-20H,1-2,9-10,12-13H2,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | LSPLYEFQRNZOIX-PMACEKPBSA-N |
| XLogP | 3.09 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |