C14H22N4O4 — CID 154911071
formic acid;1-methyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]imidazole-2-carboxamide (PubChem CID 154911071) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is formic acid;1-methyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]imidazole-2-carboxamide.
| Compound Name | formic acid;1-methyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 154911071 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | formic acid;1-methyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]imidazole-2-carboxamide |
| SMILES | Cn1ccnc1C(=O)N[C@H]1COC[C@@H]1N1CCCC1.O=CO |
| InChI | InChI=1S/C13H20N4O2.CH2O2/c1-16-7-4-14-12(16)13(18)15-10-8-19-9-11(10)17-5-2-3-6-17;2-1-3/h4,7,10-11H,2-3,5-6,8-9H2,1H3,(H,15,18);1H,(H,2,3)/t10-,11-;/m0./s1 |
| InChIKey | DMHIEQBSHMCKCV-ACMTZBLWSA-N |
| XLogP | -0.29 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|