C22H26N2O3 — CID 133265705
N-[(3S,4S)-4-morpholin-4-yloxolan-3-yl]-2-(4-phenylphenyl)acetamide (PubChem CID 133265705) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(3S,4S)-4-morpholin-4-yloxolan-3-yl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[(3S,4S)-4-morpholin-4-yloxolan-3-yl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 133265705 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(3S,4S)-4-morpholin-4-yloxolan-3-yl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)N[C@@H]1COC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C22H26N2O3/c25-22(23-20-15-27-16-21(20)24-10-12-26-13-11-24)14-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h1-9,20-21H,10-16H2,(H,23,25)/t20-,21-/m1/s1 |
| InChIKey | KZNJVQNITFWAJH-NHCUHLMSSA-N |
| XLogP | 2.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |