About formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide
formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide (PubChem CID 154907942) has the molecular formula C15H25N3O6
and a molecular weight of 343.38 g/mol. Its IUPAC name is formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| PubChem CID | 154907942 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCC1=O)N[C@H]1COC[C@@H]1N1CCOCC1.O=CO |
| InChI | InChI=1S/C14H23N3O4.CH2O2/c18-13(8-17-3-1-2-14(17)19)15-11-9-21-10-12(11)16-4-6-20-7-5-16;2-1-3/h11-12H,1-10H2,(H,15,18);1H,(H,2,3)/t11-,12-;/m0./s1 |
| InChIKey | VCVGFKPJWQRHSV-FXMYHANSSA-N |
| XLogP | -1.47 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide?
The IUPAC name of formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide (CID 154907942) is formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide.
What is the SMILES notation for formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide?
The canonical SMILES for formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide is O=C(CN1CCCC1=O)N[C@H]1COC[C@@H]1N1CCOCC1.O=CO.
What is the InChIKey of formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide?
The InChIKey is VCVGFKPJWQRHSV-FXMYHANSSA-N. The full InChI is InChI=1S/C14H23N3O4.CH2O2/c18-13(8-17-3-1-2-14(17)19)15-11-9-21-10-12(11)16-4-6-20-7-5-16;2-1-3/h11-12H,1-10H2,(H,15,18);1H,(H,2,3)/t11-,12-;/m0./s1.
What are the key properties of formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide?
formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide has a molecular weight of 343.38 g/mol, XLogP of -1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-(2-oxopyrrolidin-1-yl)acetamide is sourced from PubChem (CID 154907942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).