C14H22N4O6 — CID 154907499
2-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]acetamide;formic acid (PubChem CID 154907499) has the molecular formula C14H22N4O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]acetamide;formic acid.
| Compound Name | 2-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]acetamide;formic acid |
|---|---|
| PubChem CID | 154907499 |
| Molecular Formula | C14H22N4O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]acetamide;formic acid |
| SMILES | O=C1CN(CC(=O)N[C@H]2COC[C@@H]2N2CCCC2)C(=O)N1.O=CO |
| InChI | InChI=1S/C13H20N4O4.CH2O2/c18-11(5-17-6-12(19)15-13(17)20)14-9-7-21-8-10(9)16-3-1-2-4-16;2-1-3/h9-10H,1-8H2,(H,14,18)(H,15,19,20);1H,(H,2,3)/t9-,10-;/m0./s1 |
| InChIKey | YMLSGROGMXCKPT-IYPAPVHQSA-N |
| XLogP | -1.78 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|