C16H22N2O5 — CID 122561904
2-(2-hydroxyphenoxy)-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]acetamide (PubChem CID 122561904) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-(2-hydroxyphenoxy)-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]acetamide.
| Compound Name | 2-(2-hydroxyphenoxy)-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 122561904 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-(2-hydroxyphenoxy)-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]acetamide |
| SMILES | O=C(COc1ccccc1O)N[C@H]1COC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C16H22N2O5/c19-14-3-1-2-4-15(14)23-11-16(20)17-12-9-22-10-13(12)18-5-7-21-8-6-18/h1-4,12-13,19H,5-11H2,(H,17,20)/t12-,13-/m0/s1 |
| InChIKey | WTWLYPLWZKCSOP-STQMWFEESA-N |
| XLogP | -0.01 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |