C19H25ClN2O7 — CID 163341040
2-(2-chlorophenoxy)-N-[(1R,2R,4S)-2-hydroxy-4-(morpholine-4-carbonyl)cyclopentyl]acetamide;formic acid (PubChem CID 163341040) has the molecular formula C19H25ClN2O7 and a molecular weight of 428.87 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(1R,2R,4S)-2-hydroxy-4-(morpholine-4-carbonyl)cyclopentyl]acetamide;formic acid.
| Compound Name | 2-(2-chlorophenoxy)-N-[(1R,2R,4S)-2-hydroxy-4-(morpholine-4-carbonyl)cyclopentyl]acetamide;formic acid |
|---|---|
| PubChem CID | 163341040 |
| Molecular Formula | C19H25ClN2O7 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(1R,2R,4S)-2-hydroxy-4-(morpholine-4-carbonyl)cyclopentyl]acetamide;formic acid |
| SMILES | O=C(COc1ccccc1Cl)N[C@@H]1C[C@H](C(=O)N2CCOCC2)C[C@H]1O.O=CO |
| InChI | InChI=1S/C18H23ClN2O5.CH2O2/c19-13-3-1-2-4-16(13)26-11-17(23)20-14-9-12(10-15(14)22)18(24)21-5-7-25-8-6-21;2-1-3/h1-4,12,14-15,22H,5-11H2,(H,20,23);1H,(H,2,3)/t12-,14+,15+;/m0./s1 |
| InChIKey | WVYDBZXLTWWXSI-SQFLUBDYSA-N |
| XLogP | 0.53 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|