C19H25ClN4O5 — CID 163334048
2-(2-chlorophenoxy)-N-[(3R,4R)-4-hydroxy-1-(2-pyrazol-1-ylethyl)piperidin-3-yl]acetamide;formic acid (PubChem CID 163334048) has the molecular formula C19H25ClN4O5 and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(3R,4R)-4-hydroxy-1-(2-pyrazol-1-ylethyl)piperidin-3-yl]acetamide;formic acid.
| Compound Name | 2-(2-chlorophenoxy)-N-[(3R,4R)-4-hydroxy-1-(2-pyrazol-1-ylethyl)piperidin-3-yl]acetamide;formic acid |
|---|---|
| PubChem CID | 163334048 |
| Molecular Formula | C19H25ClN4O5 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(3R,4R)-4-hydroxy-1-(2-pyrazol-1-ylethyl)piperidin-3-yl]acetamide;formic acid |
| SMILES | O=C(COc1ccccc1Cl)N[C@@H]1CN(CCn2cccn2)CC[C@H]1O.O=CO |
| InChI | InChI=1S/C18H23ClN4O3.CH2O2/c19-14-4-1-2-5-17(14)26-13-18(25)21-15-12-22(9-6-16(15)24)10-11-23-8-3-7-20-23;2-1-3/h1-5,7-8,15-16,24H,6,9-13H2,(H,21,25);1H,(H,2,3)/t15-,16-;/m1./s1 |
| InChIKey | TUSGBJRYVRFARY-QNBGGDODSA-N |
| XLogP | 0.87 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|