C21H25ClN2O7 — CID 154890573
N-[(3R,4S)-1-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-4-hydroxypiperidin-3-yl]-2-methoxyacetamide;formic acid (PubChem CID 154890573) has the molecular formula C21H25ClN2O7 and a molecular weight of 452.89 g/mol. Its IUPAC name is N-[(3R,4S)-1-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-4-hydroxypiperidin-3-yl]-2-methoxyacetamide;formic acid.
| Compound Name | N-[(3R,4S)-1-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-4-hydroxypiperidin-3-yl]-2-methoxyacetamide;formic acid |
|---|---|
| PubChem CID | 154890573 |
| Molecular Formula | C21H25ClN2O7 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[(3R,4S)-1-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-4-hydroxypiperidin-3-yl]-2-methoxyacetamide;formic acid |
| SMILES | COCC(=O)N[C@@H]1CN(C(=O)c2cc(-c3ccccc3Cl)oc2C)CC[C@@H]1O.O=CO |
| InChI | InChI=1S/C20H23ClN2O5.CH2O2/c1-12-14(9-18(28-12)13-5-3-4-6-15(13)21)20(26)23-8-7-17(24)16(10-23)22-19(25)11-27-2;2-1-3/h3-6,9,16-17,24H,7-8,10-11H2,1-2H3,(H,22,25);1H,(H,2,3)/t16-,17+;/m1./s1 |
| InChIKey | NEZUUXMUBSLXJS-PPPUBMIESA-N |
| XLogP | 1.95 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|