C23H24ClN3O3 — CID 172662199
[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone (PubChem CID 172662199) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone |
|---|---|
| PubChem CID | 172662199 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(2-chlorophenyl)-2-methylfuran-3-yl]methanone |
| SMILES | Cc1oc(-c2ccccc2Cl)cc1C(=O)N1C[C@H]2C[C@@H](n3cccn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-14-18(11-22(30-14)17-5-2-3-6-19(17)24)23(29)26-12-15-9-20(27-8-4-7-25-27)21(28)10-16(15)13-26/h2-8,11,15-16,20-21,28H,9-10,12-13H2,1H3/t15-,16+,20-,21-/m1/s1 |
| InChIKey | YKRSUZBZHIGIEQ-VAKZPMALSA-N |
| XLogP | 4.19 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |