C18H19ClFN3O2 — CID 172656309
[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone (PubChem CID 172656309) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 172656309 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1F)N1C[C@H]2C[C@@H](n3cccn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C18H19ClFN3O2/c19-13-2-3-14(15(20)8-13)18(25)22-9-11-6-16(23-5-1-4-21-23)17(24)7-12(11)10-22/h1-5,8,11-12,16-17,24H,6-7,9-10H2/t11-,12+,16-,17-/m1/s1 |
| InChIKey | FEEVWWMIHCLINV-CZAMWMTLSA-N |
| XLogP | 2.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |