C20H26ClFN2O4 — CID 172911109
[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone;formic acid (PubChem CID 172911109) has the molecular formula C20H26ClFN2O4 and a molecular weight of 412.89 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone;formic acid.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone;formic acid |
|---|---|
| PubChem CID | 172911109 |
| Molecular Formula | C20H26ClFN2O4 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone;formic acid |
| SMILES | O=C(c1ccc(Cl)cc1F)N1C[C@H]2C[C@@H](N3CCCC3)[C@H](O)C[C@H]2C1.O=CO |
| InChI | InChI=1S/C19H24ClFN2O2.CH2O2/c20-14-3-4-15(16(21)9-14)19(25)23-10-12-7-17(22-5-1-2-6-22)18(24)8-13(12)11-23;2-1-3/h3-4,9,12-13,17-18,24H,1-2,5-8,10-11H2;1H,(H,2,3)/t12-,13+,17-,18-;/m1./s1 |
| InChIKey | GAFQTIHAGIMMOU-LBFIHCRWSA-N |
| XLogP | 2.49 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|