C25H30N2O3 — CID 172672484
[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(4-hydroxyphenyl)phenyl]methanone (PubChem CID 172672484) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(4-hydroxyphenyl)phenyl]methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(4-hydroxyphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 172672484 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(4-hydroxyphenyl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(O)cc2)cc1)N1C[C@H]2C[C@@H](N3CCCC3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C25H30N2O3/c28-22-9-7-18(8-10-22)17-3-5-19(6-4-17)25(30)27-15-20-13-23(26-11-1-2-12-26)24(29)14-21(20)16-27/h3-10,20-21,23-24,28-29H,1-2,11-16H2/t20-,21+,23-,24-/m1/s1 |
| InChIKey | RDAUZKFZSXPSDY-CBJLPSGESA-N |
| XLogP | 3.37 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |