C22H32N2O2 — CID 172658717
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one (PubChem CID 172658717) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 172658717 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-methyl-2-phenylpropan-1-one |
| SMILES | CC(C)(C(=O)N1C[C@H]2C[C@@H](N3CCCC3)[C@H](O)C[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O2/c1-22(2,18-8-4-3-5-9-18)21(26)24-14-16-12-19(23-10-6-7-11-23)20(25)13-17(16)15-24/h3-5,8-9,16-17,19-20,25H,6-7,10-15H2,1-2H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | HRNLCVRWYKUQBM-PIKOESSRSA-N |
| XLogP | 2.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |