C19H24ClFN2O2 — CID 172669997
[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone (PubChem CID 172669997) has the molecular formula C19H24ClFN2O2 and a molecular weight of 366.86 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 172669997 |
| Molecular Formula | C19H24ClFN2O2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-chloro-2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1F)N1C[C@H]2C[C@@H](N3CCCC3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H24ClFN2O2/c20-14-3-4-15(16(21)9-14)19(25)23-10-12-7-17(22-5-1-2-6-22)18(24)8-13(12)11-23/h3-4,9,12-13,17-18,24H,1-2,5-8,10-11H2/t12-,13+,17-,18-/m1/s1 |
| InChIKey | GQNRJHBLYBKPOQ-JGTCGTHISA-N |
| XLogP | 2.79 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |