C18H22ClFN2O — CID 86813261
[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-(4-chloro-2-fluorophenyl)methanone (PubChem CID 86813261) has the molecular formula C18H22ClFN2O and a molecular weight of 336.84 g/mol. Its IUPAC name is [4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-(4-chloro-2-fluorophenyl)methanone.
| Compound Name | [4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-(4-chloro-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 86813261 |
| Molecular Formula | C18H22ClFN2O |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-(4-chloro-2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1F)N1CCN(C2CC3CCC2C3)CC1 |
| InChI | InChI=1S/C18H22ClFN2O/c19-14-3-4-15(16(20)11-14)18(23)22-7-5-21(6-8-22)17-10-12-1-2-13(17)9-12/h3-4,11-13,17H,1-2,5-10H2 |
| InChIKey | BLSIFPQOGHHAAV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |