C24H30N2O4 — CID 172673874
[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(5-methylfuran-2-yl)phenyl]methanone (PubChem CID 172673874) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(5-methylfuran-2-yl)phenyl]methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(5-methylfuran-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 172673874 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(5-methylfuran-2-yl)phenyl]methanone |
| SMILES | Cc1ccc(-c2ccc(C(=O)N3C[C@H]4C[C@@H](N5CCOCC5)[C@H](O)C[C@H]4C3)cc2)o1 |
| InChI | InChI=1S/C24H30N2O4/c1-16-2-7-23(30-16)17-3-5-18(6-4-17)24(28)26-14-19-12-21(22(27)13-20(19)15-26)25-8-10-29-11-9-25/h2-7,19-22,27H,8-15H2,1H3/t19-,20+,21-,22-/m1/s1 |
| InChIKey | UXXVWOBDEZWIAI-CIAFKFPVSA-N |
| XLogP | 2.80 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |