C23H34N2O6 — CID 172913347
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2,3-dimethylphenoxy)ethanone;formic acid (PubChem CID 172913347) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2,3-dimethylphenoxy)ethanone;formic acid.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2,3-dimethylphenoxy)ethanone;formic acid |
|---|---|
| PubChem CID | 172913347 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-morpholin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(2,3-dimethylphenoxy)ethanone;formic acid |
| SMILES | Cc1cccc(OCC(=O)N2C[C@H]3C[C@@H](N4CCOCC4)[C@H](O)C[C@H]3C2)c1C.O=CO |
| InChI | InChI=1S/C22H32N2O4.CH2O2/c1-15-4-3-5-21(16(15)2)28-14-22(26)24-12-17-10-19(20(25)11-18(17)13-24)23-6-8-27-9-7-23;2-1-3/h3-5,17-20,25H,6-14H2,1-2H3;1H,(H,2,3)/t17-,18+,19-,20-;/m1./s1 |
| InChIKey | ZHYKSYSBSKJZEM-BOJUQBCTSA-N |
| XLogP | 1.31 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|