C23H32N4O3 — CID 172663596
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]ethanone (PubChem CID 172663596) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]ethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]ethanone |
|---|---|
| PubChem CID | 172663596 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]ethanone |
| SMILES | Cc1cccc2[nH]c(COCC(=O)N3C[C@H]4C[C@@H](N5CCCC5)[C@H](O)C[C@H]4C3)nc12 |
| InChI | InChI=1S/C23H32N4O3/c1-15-5-4-6-18-23(15)25-21(24-18)13-30-14-22(29)27-11-16-9-19(26-7-2-3-8-26)20(28)10-17(16)12-27/h4-6,16-17,19-20,28H,2-3,7-14H2,1H3,(H,24,25)/t16-,17+,19-,20-/m1/s1 |
| InChIKey | ZTYGDDHKJFTKEC-PIKOESSRSA-N |
| XLogP | 2.08 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |